C20H30O4SSi — CID 11036671
(4R,5R,6R)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethylcyclohex-2-en-1-one (PubChem CID 11036671) has the molecular formula C20H30O4SSi and a molecular weight of 394.61 g/mol. Its IUPAC name is (4R,5R,6R)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethylcyclohex-2-en-1-one.
| Compound Name | (4R,5R,6R)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11036671 |
| Molecular Formula | C20H30O4SSi |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (4R,5R,6R)-2-(benzenesulfonyl)-4-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethylcyclohex-2-en-1-one |
| SMILES | C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C=C(S(=O)(=O)c2ccccc2)C(=O)[C@@H]1C |
| InChI | InChI=1S/C20H30O4SSi/c1-14-15(2)19(21)18(25(22,23)16-11-9-8-10-12-16)13-17(14)24-26(6,7)20(3,4)5/h8-15,17H,1-7H3/t14-,15-,17+/m1/s1 |
| InChIKey | FNZCCXNPWBDCOA-INMHGKMJSA-N |
| XLogP | 4.59 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|