C18H24N2O4S2 — CID 11036713
N,N'-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 11036713) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is N,N'-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N,N'-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 11036713 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N,N'-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-ylmethyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CN(CCN(C)Cc1scc2c1OCCO2)Cc1scc2c1OCCO2 |
| InChI | InChI=1S/C18H24N2O4S2/c1-19(9-15-17-13(11-25-15)21-5-7-23-17)3-4-20(2)10-16-18-14(12-26-16)22-6-8-24-18/h11-12H,3-10H2,1-2H3 |
| InChIKey | LGCOVBWRKDAGCH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |