C21H24N2O4 — CID 110367710
N-[[4-(4-ethylphenyl)-5-oxomorpholin-2-yl]methyl]-3-methoxybenzamide (PubChem CID 110367710) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N-[[4-(4-ethylphenyl)-5-oxomorpholin-2-yl]methyl]-3-methoxybenzamide.
| Compound Name | N-[[4-(4-ethylphenyl)-5-oxomorpholin-2-yl]methyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 110367710 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-[[4-(4-ethylphenyl)-5-oxomorpholin-2-yl]methyl]-3-methoxybenzamide |
| SMILES | CCc1ccc(N2CC(CNC(=O)c3cccc(OC)c3)OCC2=O)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-3-15-7-9-17(10-8-15)23-13-19(27-14-20(23)24)12-22-21(25)16-5-4-6-18(11-16)26-2/h4-11,19H,3,12-14H2,1-2H3,(H,22,25) |
| InChIKey | BMIPFDZFJSQJSP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |