C18H24N4OS — CID 110368636
1-benzyl-3-[[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]methyl]urea (PubChem CID 110368636) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-benzyl-3-[[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]methyl]urea.
| Compound Name | 1-benzyl-3-[[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 110368636 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-benzyl-3-[[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]methyl]urea |
| SMILES | O=C(NCc1ccccc1)NCc1nc(CN2CCCCC2)cs1 |
| InChI | InChI=1S/C18H24N4OS/c23-18(19-11-15-7-3-1-4-8-15)20-12-17-21-16(14-24-17)13-22-9-5-2-6-10-22/h1,3-4,7-8,14H,2,5-6,9-13H2,(H2,19,20,23) |
| InChIKey | ZANXRUDOBFICAS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |