C10H17ClHgO2 — CID 11036904
chloro-[[(2S,4S,6R)-2-ethyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]methyl]mercury (PubChem CID 11036904) has the molecular formula C10H17ClHgO2 and a molecular weight of 405.29 g/mol. Its IUPAC name is chloro-[[(2S,4S,6R)-2-ethyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]methyl]mercury.
| Compound Name | chloro-[[(2S,4S,6R)-2-ethyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]methyl]mercury |
|---|---|
| PubChem CID | 11036904 |
| Molecular Formula | C10H17ClHgO2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | chloro-[[(2S,4S,6R)-2-ethyl-6-[(E)-prop-1-enyl]-1,3-dioxan-4-yl]methyl]mercury |
| SMILES | C/C=C/[C@H]1C[C@@H](C[Hg]Cl)O[C@@H](CC)O1 |
| InChI | InChI=1S/C10H17O2.ClH.Hg/c1-4-6-9-7-8(3)11-10(5-2)12-9;;/h4,6,8-10H,3,5,7H2,1-2H3;1H;/q;;+1/p-1/b6-4+;;/t8-,9+,10-;;/m1../s1 |
| InChIKey | PMZFZTJKEJJFJN-YZDKAQEHSA-M |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|