C17H22F3N3O3S — CID 11036907
N-[2-[6-(2-amino-N-methylsulfonylanilino)cyclohexen-1-yl]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 11036907) has the molecular formula C17H22F3N3O3S and a molecular weight of 405.44 g/mol. Its IUPAC name is N-[2-[6-(2-amino-N-methylsulfonylanilino)cyclohexen-1-yl]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-[6-(2-amino-N-methylsulfonylanilino)cyclohexen-1-yl]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11036907 |
| Molecular Formula | C17H22F3N3O3S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[2-[6-(2-amino-N-methylsulfonylanilino)cyclohexen-1-yl]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | CS(=O)(=O)N(c1ccccc1N)C1CCCC=C1CCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H22F3N3O3S/c1-27(25,26)23(15-9-5-3-7-13(15)21)14-8-4-2-6-12(14)10-11-22-16(24)17(18,19)20/h3,5-7,9,14H,2,4,8,10-11,21H2,1H3,(H,22,24) |
| InChIKey | BTKUQZJXLVTESM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|