C21H38O2Si3 — CID 11036939
2,2-dimethyl-1-[(2,4,6-trimethylbenzoyl)-bis(trimethylsilyl)silyl]propan-1-one (PubChem CID 11036939) has the molecular formula C21H38O2Si3 and a molecular weight of 406.79 g/mol. Its IUPAC name is 2,2-dimethyl-1-[(2,4,6-trimethylbenzoyl)-bis(trimethylsilyl)silyl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[(2,4,6-trimethylbenzoyl)-bis(trimethylsilyl)silyl]propan-1-one |
|---|---|
| PubChem CID | 11036939 |
| Molecular Formula | C21H38O2Si3 |
| Molecular Weight | 406.79 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 2,2-dimethyl-1-[(2,4,6-trimethylbenzoyl)-bis(trimethylsilyl)silyl]propan-1-one |
| SMILES | Cc1cc(C)c(C(=O)[Si](C(=O)C(C)(C)C)([Si](C)(C)C)[Si](C)(C)C)c(C)c1 |
| InChI | InChI=1S/C21H38O2Si3/c1-15-13-16(2)18(17(3)14-15)19(22)26(24(7,8)9,25(10,11)12)20(23)21(4,5)6/h13-14H,1-12H3 |
| InChIKey | HXVHBDWJBJWNRX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.79 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|