C24H44O3Si — CID 11036985
(2E,5S,6R,7R,8R,9R,10E)-6-[tert-butyl(dimethyl)silyl]oxy-3,5,7,9,11-pentamethyltrideca-2,10-dien-12-yne-1,8-diol (PubChem CID 11036985) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is (2E,5S,6R,7R,8R,9R,10E)-6-[tert-butyl(dimethyl)silyl]oxy-3,5,7,9,11-pentamethyltrideca-2,10-dien-12-yne-1,8-diol.
| Compound Name | (2E,5S,6R,7R,8R,9R,10E)-6-[tert-butyl(dimethyl)silyl]oxy-3,5,7,9,11-pentamethyltrideca-2,10-dien-12-yne-1,8-diol |
|---|---|
| PubChem CID | 11036985 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | (2E,5S,6R,7R,8R,9R,10E)-6-[tert-butyl(dimethyl)silyl]oxy-3,5,7,9,11-pentamethyltrideca-2,10-dien-12-yne-1,8-diol |
| SMILES | C#C/C(C)=C/[C@@H](C)[C@@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C/C(C)=C/CO |
| InChI | InChI=1S/C24H44O3Si/c1-12-17(2)15-19(4)22(26)21(6)23(20(5)16-18(3)13-14-25)27-28(10,11)24(7,8)9/h1,13,15,19-23,25-26H,14,16H2,2-11H3/b17-15+,18-13+/t19-,20+,21-,22-,23-/m1/s1 |
| InChIKey | HCDCOROLJCIJTO-PSIHIKTHSA-N |
| XLogP | 5.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|