About N-[2-(1,3-dioxan-2-yl)ethyl]propanamide
N-[2-(1,3-dioxan-2-yl)ethyl]propanamide (PubChem CID 110370043) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is N-[2-(1,3-dioxan-2-yl)ethyl]propanamide.
Molecular Properties
| Compound Name | N-[2-(1,3-dioxan-2-yl)ethyl]propanamide |
| PubChem CID | 110370043 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | N-[2-(1,3-dioxan-2-yl)ethyl]propanamide |
| SMILES | CCC(=O)NCCC1OCCCO1 |
| InChI | InChI=1S/C9H17NO3/c1-2-8(11)10-5-4-9-12-6-3-7-13-9/h9H,2-7H2,1H3,(H,10,11) |
| InChIKey | RCCPEDQYWLUMJE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(1,3-dioxan-2-yl)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,3-dioxan-2-yl)ethyl]propanamide?
The IUPAC name of N-[2-(1,3-dioxan-2-yl)ethyl]propanamide (CID 110370043) is N-[2-(1,3-dioxan-2-yl)ethyl]propanamide.
What is the SMILES notation for N-[2-(1,3-dioxan-2-yl)ethyl]propanamide?
The canonical SMILES for N-[2-(1,3-dioxan-2-yl)ethyl]propanamide is CCC(=O)NCCC1OCCCO1.
What is the InChIKey of N-[2-(1,3-dioxan-2-yl)ethyl]propanamide?
The InChIKey is RCCPEDQYWLUMJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-2-8(11)10-5-4-9-12-6-3-7-13-9/h9H,2-7H2,1H3,(H,10,11).
What are the key properties of N-[2-(1,3-dioxan-2-yl)ethyl]propanamide?
N-[2-(1,3-dioxan-2-yl)ethyl]propanamide has a molecular weight of 187.24 g/mol, XLogP of 0.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,3-dioxan-2-yl)ethyl]propanamide is sourced from PubChem (CID 110370043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).