C17H19N3O3 — CID 110371629
4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]piperazine-1-carbaldehyde (PubChem CID 110371629) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 110371629 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetyl]piperazine-1-carbaldehyde |
| SMILES | Cc1oc(-c2ccccc2)nc1CC(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C17H19N3O3/c1-13-15(18-17(23-13)14-5-3-2-4-6-14)11-16(22)20-9-7-19(12-21)8-10-20/h2-6,12H,7-11H2,1H3 |
| InChIKey | IHABOGDILSRVQY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|