C25H47NO2Si — CID 11037229
(3R,5S,7aR,11aR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hexyl-1,2,3,5,6,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-7-one (PubChem CID 11037229) has the molecular formula C25H47NO2Si and a molecular weight of 421.74 g/mol. Its IUPAC name is (3R,5S,7aR,11aR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hexyl-1,2,3,5,6,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-7-one.
| Compound Name | (3R,5S,7aR,11aR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hexyl-1,2,3,5,6,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-7-one |
|---|---|
| PubChem CID | 11037229 |
| Molecular Formula | C25H47NO2Si |
| Molecular Weight | 421.74 g/mol |
| Exact Mass | 421.34 |
| IUPAC Name | (3R,5S,7aR,11aR)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hexyl-1,2,3,5,6,7a,8,9,10,11-decahydropyrrolo[2,1-j]quinolin-7-one |
| SMILES | CCCCCC[C@H]1CC(=O)[C@@H]2CCCC[C@@]23CC[C@H](CO[Si](C)(C)C(C)(C)C)N13 |
| InChI | InChI=1S/C25H47NO2Si/c1-7-8-9-10-13-20-18-23(27)22-14-11-12-16-25(22)17-15-21(26(20)25)19-28-29(5,6)24(2,3)4/h20-22H,7-19H2,1-6H3/t20-,21+,22-,25+/m0/s1 |
| InChIKey | MVRMNXIHBPWOKX-XOEOCAAJSA-N |
| XLogP | 6.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.74 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|