C20H24N2O — CID 110373483
2-(2-methylphenyl)-1-(4-methylpiperidin-1-yl)-2-pyridin-2-ylethanone (PubChem CID 110373483) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1-(4-methylpiperidin-1-yl)-2-pyridin-2-ylethanone.
| Compound Name | 2-(2-methylphenyl)-1-(4-methylpiperidin-1-yl)-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 110373483 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 2-(2-methylphenyl)-1-(4-methylpiperidin-1-yl)-2-pyridin-2-ylethanone |
| SMILES | Cc1ccccc1C(C(=O)N1CCC(C)CC1)c1ccccn1 |
| InChI | InChI=1S/C20H24N2O/c1-15-10-13-22(14-11-15)20(23)19(18-9-5-6-12-21-18)17-8-4-3-7-16(17)2/h3-9,12,15,19H,10-11,13-14H2,1-2H3 |
| InChIKey | PUBOYFKCOJRAIE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |