C20H36O8Si — CID 11037429
dimethyl (1S,2R,3S,4S,5R,6S)-5,6-dihydroxy-1-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 11037429) has the molecular formula C20H36O8Si and a molecular weight of 432.59 g/mol. Its IUPAC name is dimethyl (1S,2R,3S,4S,5R,6S)-5,6-dihydroxy-1-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3S,4S,5R,6S)-5,6-dihydroxy-1-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11037429 |
| Molecular Formula | C20H36O8Si |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | dimethyl (1S,2R,3S,4S,5R,6S)-5,6-dihydroxy-1-[tri(propan-2-yl)silyloxymethyl]-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2O[C@](CO[Si](C(C)C)(C(C)C)C(C)C)([C@@H]1C(=O)OC)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C20H36O8Si/c1-10(2)29(11(3)4,12(5)6)27-9-20-14(19(24)26-8)13(18(23)25-7)16(28-20)15(21)17(20)22/h10-17,21-22H,9H2,1-8H3/t13-,14-,15-,16-,17-,20+/m0/s1 |
| InChIKey | HYPCERBAKVJDSJ-CLTKYUOCSA-N |
| XLogP | 1.63 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|