C25H28O7 — CID 11037550
8-(2,3-dihydroxy-3-methylbutyl)-5,7-dihydroxy-6-(2-methylbutanoyl)-4-phenylchromen-2-one (PubChem CID 11037550) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is 8-(2,3-dihydroxy-3-methylbutyl)-5,7-dihydroxy-6-(2-methylbutanoyl)-4-phenylchromen-2-one.
| Compound Name | 8-(2,3-dihydroxy-3-methylbutyl)-5,7-dihydroxy-6-(2-methylbutanoyl)-4-phenylchromen-2-one |
|---|---|
| PubChem CID | 11037550 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 8-(2,3-dihydroxy-3-methylbutyl)-5,7-dihydroxy-6-(2-methylbutanoyl)-4-phenylchromen-2-one |
| SMILES | CCC(C)C(=O)c1c(O)c(CC(O)C(C)(C)O)c2oc(=O)cc(-c3ccccc3)c2c1O |
| InChI | InChI=1S/C25H28O7/c1-5-13(2)21(28)20-22(29)16(11-17(26)25(3,4)31)24-19(23(20)30)15(12-18(27)32-24)14-9-7-6-8-10-14/h6-10,12-13,17,26,29-31H,5,11H2,1-4H3 |
| InChIKey | DFBLQWGFTJWAOT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|