C26H36N2O4 — CID 11037555
propan-2-yl 2-[(1R,9R,12S,19R)-5,6-dimethoxy-8-methyl-11-methylidene-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]acetate (PubChem CID 11037555) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is propan-2-yl 2-[(1R,9R,12S,19R)-5,6-dimethoxy-8-methyl-11-methylidene-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]acetate.
| Compound Name | propan-2-yl 2-[(1R,9R,12S,19R)-5,6-dimethoxy-8-methyl-11-methylidene-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]acetate |
|---|---|
| PubChem CID | 11037555 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | propan-2-yl 2-[(1R,9R,12S,19R)-5,6-dimethoxy-8-methyl-11-methylidene-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2(7),3,5-trien-12-yl]acetate |
| SMILES | C=C1C[C@H]2N(C)c3c(ccc(OC)c3OC)[C@]23CCN2CCC[C@@]1(CC(=O)OC(C)C)[C@@H]23 |
| InChI | InChI=1S/C26H36N2O4/c1-16(2)32-21(29)15-25-10-7-12-28-13-11-26(24(25)28)18-8-9-19(30-5)23(31-6)22(18)27(4)20(26)14-17(25)3/h8-9,16,20,24H,3,7,10-15H2,1-2,4-6H3/t20-,24-,25+,26-/m1/s1 |
| InChIKey | SKSSLSATXIORED-YEHREXKJSA-N |
| XLogP | 3.92 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|