C18H30INOSSi — CID 11037924
tert-butyl-[(1E,3S,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxy-dimethylsilane (PubChem CID 11037924) has the molecular formula C18H30INOSSi and a molecular weight of 463.50 g/mol. Its IUPAC name is tert-butyl-[(1E,3S,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1E,3S,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11037924 |
| Molecular Formula | C18H30INOSSi |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | tert-butyl-[(1E,3S,5Z)-6-iodo-2-methyl-1-(2-methyl-1,3-thiazol-4-yl)hepta-1,5-dien-3-yl]oxy-dimethylsilane |
| SMILES | C/C(I)=C/C[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C18H30INOSSi/c1-13(11-16-12-22-15(3)20-16)17(10-9-14(2)19)21-23(7,8)18(4,5)6/h9,11-12,17H,10H2,1-8H3/b13-11+,14-9-/t17-/m0/s1 |
| InChIKey | FGYIEZJWWKGRAB-QEHIOZLBSA-N |
| XLogP | 6.97 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|