C28H36O5Si — CID 11038169
(1S,3R,6R,8S,10R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-one (PubChem CID 11038169) has the molecular formula C28H36O5Si and a molecular weight of 480.68 g/mol. Its IUPAC name is (1S,3R,6R,8S,10R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-one.
| Compound Name | (1S,3R,6R,8S,10R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-one |
|---|---|
| PubChem CID | 11038169 |
| Molecular Formula | C28H36O5Si |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (1S,3R,6R,8S,10R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H]2C[C@H]3OCCC[C@@H]3O[C@@H]2CC1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H36O5Si/c1-28(2,3)34(20-11-6-4-7-12-20,21-13-8-5-9-14-21)31-19-27-22(29)17-25-26(33-27)18-24-23(32-25)15-10-16-30-24/h4-9,11-14,23-27H,10,15-19H2,1-3H3/t23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | PUUWIGUSJBKFIS-SHZNSVIDSA-N |
| XLogP | 3.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|