C26H48O6Si — CID 11038220
(8S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-hydroxy-8-methyltetradec-13-ene-4,7-dione (PubChem CID 11038220) has the molecular formula C26H48O6Si and a molecular weight of 484.75 g/mol. Its IUPAC name is (8S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-hydroxy-8-methyltetradec-13-ene-4,7-dione.
| Compound Name | (8S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-hydroxy-8-methyltetradec-13-ene-4,7-dione |
|---|---|
| PubChem CID | 11038220 |
| Molecular Formula | C26H48O6Si |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (8S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-8-hydroxy-8-methyltetradec-13-ene-4,7-dione |
| SMILES | C=CC[C@@H](CC[C@](C)(O)C(=O)CCC(=O)CCC[C@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O6Si/c1-10-12-21(32-33(8,9)24(2,3)4)17-18-26(7,29)23(28)16-15-20(27)13-11-14-22-19-30-25(5,6)31-22/h10,21-22,29H,1,11-19H2,2-9H3/t21-,22-,26-/m0/s1 |
| InChIKey | JIUMAQPYNPQNGS-MCEYFSPLSA-N |
| XLogP | 5.72 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|