C17H20N4O2S — CID 110382511
5-[[bis(prop-2-enyl)amino]-(furan-2-yl)methyl]-2-ethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol (PubChem CID 110382511) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 5-[[bis(prop-2-enyl)amino]-(furan-2-yl)methyl]-2-ethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol.
| Compound Name | 5-[[bis(prop-2-enyl)amino]-(furan-2-yl)methyl]-2-ethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
|---|---|
| PubChem CID | 110382511 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 5-[[bis(prop-2-enyl)amino]-(furan-2-yl)methyl]-2-ethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-6-ol |
| SMILES | C=CCN(CC=C)C(c1ccco1)c1sc2nc(CC)nn2c1O |
| InChI | InChI=1S/C17H20N4O2S/c1-4-9-20(10-5-2)14(12-8-7-11-23-12)15-16(22)21-17(24-15)18-13(6-3)19-21/h4-5,7-8,11,14,22H,1-2,6,9-10H2,3H3 |
| InChIKey | XVSAKNIZMWHUDF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|