C23H22N2O4 — CID 110382640
ethyl 2-[[1-[(4-methylphenyl)methyl]-2-oxopyridine-3-carbonyl]amino]benzoate (PubChem CID 110382640) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is ethyl 2-[[1-[(4-methylphenyl)methyl]-2-oxopyridine-3-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[1-[(4-methylphenyl)methyl]-2-oxopyridine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 110382640 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | ethyl 2-[[1-[(4-methylphenyl)methyl]-2-oxopyridine-3-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1cccn(Cc2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C23H22N2O4/c1-3-29-23(28)18-7-4-5-9-20(18)24-21(26)19-8-6-14-25(22(19)27)15-17-12-10-16(2)11-13-17/h4-14H,3,15H2,1-2H3,(H,24,26) |
| InChIKey | QQGGWTJXPDNDIR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |