C24H54O4Si3 — CID 11038303
(3S,4R,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]hexanal (PubChem CID 11038303) has the molecular formula C24H54O4Si3 and a molecular weight of 490.95 g/mol. Its IUPAC name is (3S,4R,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]hexanal.
| Compound Name | (3S,4R,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]hexanal |
|---|---|
| PubChem CID | 11038303 |
| Molecular Formula | C24H54O4Si3 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | (3S,4R,5R)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]hexanal |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H54O4Si3/c1-19(26-29(11,12)22(2,3)4)21(28-31(15,16)24(8,9)10)20(17-18-25)27-30(13,14)23(5,6)7/h18-21H,17H2,1-16H3/t19-,20+,21-/m1/s1 |
| InChIKey | QYBLCABMGYYRPG-QHAWAJNXSA-N |
| XLogP | 7.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|