C22H21N3O3 — CID 110383049
N-(4-carbamoylphenyl)-1-[(4-ethylphenyl)methyl]-6-oxopyridine-3-carboxamide (PubChem CID 110383049) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-(4-carbamoylphenyl)-1-[(4-ethylphenyl)methyl]-6-oxopyridine-3-carboxamide.
| Compound Name | N-(4-carbamoylphenyl)-1-[(4-ethylphenyl)methyl]-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 110383049 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-(4-carbamoylphenyl)-1-[(4-ethylphenyl)methyl]-6-oxopyridine-3-carboxamide |
| SMILES | CCc1ccc(Cn2cc(C(=O)Nc3ccc(C(N)=O)cc3)ccc2=O)cc1 |
| InChI | InChI=1S/C22H21N3O3/c1-2-15-3-5-16(6-4-15)13-25-14-18(9-12-20(25)26)22(28)24-19-10-7-17(8-11-19)21(23)27/h3-12,14H,2,13H2,1H3,(H2,23,27)(H,24,28) |
| InChIKey | GPIJMENGVNJCJQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |