C28H58O3Si2 — CID 11038385
[(2R,3S,4S)-3-methyl-2-[4-tri(propan-2-yl)silyloxybutyl]-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane (PubChem CID 11038385) has the molecular formula C28H58O3Si2 and a molecular weight of 498.94 g/mol. Its IUPAC name is [(2R,3S,4S)-3-methyl-2-[4-tri(propan-2-yl)silyloxybutyl]-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(2R,3S,4S)-3-methyl-2-[4-tri(propan-2-yl)silyloxybutyl]-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11038385 |
| Molecular Formula | C28H58O3Si2 |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.39 |
| IUPAC Name | [(2R,3S,4S)-3-methyl-2-[4-tri(propan-2-yl)silyloxybutyl]-3,4-dihydro-2H-pyran-4-yl]oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OCCCC[C@H]1OC=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H58O3Si2/c1-20(2)32(21(3)4,22(5)6)30-18-15-14-16-27-26(13)28(17-19-29-27)31-33(23(7)8,24(9)10)25(11)12/h17,19-28H,14-16,18H2,1-13H3/t26-,27+,28-/m0/s1 |
| InChIKey | VMZRQCAVSUBOGE-IARZGTGTSA-N |
| XLogP | 9.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|