C13H13N5OS — CID 110384800
N-benzyl-N,3-dimethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide (PubChem CID 110384800) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is N-benzyl-N,3-dimethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide.
| Compound Name | N-benzyl-N,3-dimethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide |
|---|---|
| PubChem CID | 110384800 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-benzyl-N,3-dimethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide |
| SMILES | Cc1nnc2sc(C(=O)N(C)Cc3ccccc3)nn12 |
| InChI | InChI=1S/C13H13N5OS/c1-9-14-15-13-18(9)16-11(20-13)12(19)17(2)8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3 |
| InChIKey | PPKDXUSPGYKEOC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |