C14H13N5OS — CID 110384951
(2-methyl-2,3-dihydroindol-1-yl)-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methanone (PubChem CID 110384951) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is (2-methyl-2,3-dihydroindol-1-yl)-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methanone.
| Compound Name | (2-methyl-2,3-dihydroindol-1-yl)-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methanone |
|---|---|
| PubChem CID | 110384951 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (2-methyl-2,3-dihydroindol-1-yl)-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methanone |
| SMILES | Cc1nnc2sc(C(=O)N3c4ccccc4CC3C)nn12 |
| InChI | InChI=1S/C14H13N5OS/c1-8-7-10-5-3-4-6-11(10)18(8)13(20)12-17-19-9(2)15-16-14(19)21-12/h3-6,8H,7H2,1-2H3 |
| InChIKey | IXTIIDSDKCOAQY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |