C27H52O5Si2 — CID 11038543
(3S,5R,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(4-methoxyphenyl)methoxy]heptan-1-ol (PubChem CID 11038543) has the molecular formula C27H52O5Si2 and a molecular weight of 512.88 g/mol. Its IUPAC name is (3S,5R,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(4-methoxyphenyl)methoxy]heptan-1-ol.
| Compound Name | (3S,5R,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(4-methoxyphenyl)methoxy]heptan-1-ol |
|---|---|
| PubChem CID | 11038543 |
| Molecular Formula | C27H52O5Si2 |
| Molecular Weight | 512.88 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | (3S,5R,6R)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(4-methoxyphenyl)methoxy]heptan-1-ol |
| SMILES | COc1ccc(CO[C@@H](CCO)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H52O5Si2/c1-21(31-33(9,10)26(2,3)4)25(32-34(11,12)27(5,6)7)19-24(17-18-28)30-20-22-13-15-23(29-8)16-14-22/h13-16,21,24-25,28H,17-20H2,1-12H3/t21-,24+,25-/m1/s1 |
| InChIKey | QHWNBNMPLQFXHE-IEZKXTBUSA-N |
| XLogP | 7.15 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.88 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|