C30H44O6S — CID 11038761
[(2E,6E)-9-(benzenesulfonyl)-8-(methoxymethoxy)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate (PubChem CID 11038761) has the molecular formula C30H44O6S and a molecular weight of 532.74 g/mol. Its IUPAC name is [(2E,6E)-9-(benzenesulfonyl)-8-(methoxymethoxy)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate.
| Compound Name | [(2E,6E)-9-(benzenesulfonyl)-8-(methoxymethoxy)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 11038761 |
| Molecular Formula | C30H44O6S |
| Molecular Weight | 532.74 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | [(2E,6E)-9-(benzenesulfonyl)-8-(methoxymethoxy)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,6-dienyl] acetate |
| SMILES | COCOC(/C(C)=C/CC/C(C)=C/COC(C)=O)C(C1=C(C)CCCC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H44O6S/c1-22(18-20-35-25(4)31)13-11-14-24(3)28(36-21-34-7)29(27-23(2)15-12-19-30(27,5)6)37(32,33)26-16-9-8-10-17-26/h8-10,14,16-18,28-29H,11-13,15,19-21H2,1-7H3/b22-18+,24-14+ |
| InChIKey | NJNBYEXSBYRKGC-KDGGPIOESA-N |
| XLogP | 6.58 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.74 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|