C31H40O6Si — CID 11038791
[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy-trimethylsilane (PubChem CID 11038791) has the molecular formula C31H40O6Si and a molecular weight of 536.74 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy-trimethylsilane.
| Compound Name | [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy-trimethylsilane |
|---|---|
| PubChem CID | 11038791 |
| Molecular Formula | C31H40O6Si |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy-trimethylsilane |
| SMILES | CO[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H40O6Si/c1-32-31-30(35-22-26-18-12-7-13-19-26)29(34-21-25-16-10-6-11-17-25)28(27(37-31)23-36-38(2,3)4)33-20-24-14-8-5-9-15-24/h5-19,27-31H,20-23H2,1-4H3/t27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | CFUUEMFCDXOFOA-SAEUYMBFSA-N |
| XLogP | 5.97 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|