C16H14N2O3 — CID 110388014
N-(3-methoxyphenyl)-2-methyl-1,3-benzoxazole-5-carboxamide (PubChem CID 110388014) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-methyl-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-(3-methoxyphenyl)-2-methyl-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 110388014 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(3-methoxyphenyl)-2-methyl-1,3-benzoxazole-5-carboxamide |
| SMILES | COc1cccc(NC(=O)c2ccc3oc(C)nc3c2)c1 |
| InChI | InChI=1S/C16H14N2O3/c1-10-17-14-8-11(6-7-15(14)21-10)16(19)18-12-4-3-5-13(9-12)20-2/h3-9H,1-2H3,(H,18,19) |
| InChIKey | HDHMGTLTEKBBJX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |