C28H46O8S — CID 11038846
[(1S,3S,4aS,7S,8S,8aS)-3-[(S)-2-acetyloxyethylsulfinyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 11038846) has the molecular formula C28H46O8S and a molecular weight of 542.74 g/mol. Its IUPAC name is [(1S,3S,4aS,7S,8S,8aS)-3-[(S)-2-acetyloxyethylsulfinyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3S,4aS,7S,8S,8aS)-3-[(S)-2-acetyloxyethylsulfinyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 11038846 |
| Molecular Formula | C28H46O8S |
| Molecular Weight | 542.74 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | [(1S,3S,4aS,7S,8S,8aS)-3-[(S)-2-acetyloxyethylsulfinyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@@H]([S@@](=O)CCOC(C)=O)C[C@@H]2CC[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C28H46O8S/c1-6-28(4,5)27(32)36-24-16-22(37(33)12-11-34-18(3)29)13-19-8-7-17(2)23(26(19)24)10-9-21-14-20(30)15-25(31)35-21/h17,19-24,26,30H,6-16H2,1-5H3/t17-,19-,20+,21+,22-,23-,24-,26-,37-/m0/s1 |
| InChIKey | UAHDKLQCCKFMAS-HUSZSLLJSA-N |
| XLogP | 3.93 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.74 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|