About [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane
[3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane (PubChem CID 11038971) has the molecular formula C13H26O2Si2
and a molecular weight of 270.52 g/mol. Its IUPAC name is [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane.
Molecular Properties
| Compound Name | [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane |
| PubChem CID | 11038971 |
| Molecular Formula | C13H26O2Si2 |
| Molecular Weight | 270.52 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane |
| SMILES | C[C@H]1O[C@]1(C)C(C#C[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H26O2Si2/c1-11-13(2,14-11)12(15-17(6,7)8)9-10-16(3,4)5/h11-12H,1-8H3/t11-,12?,13+/m1/s1 |
| InChIKey | LYKGJDAUZZAXHE-YPHAAILGSA-N |
| XLogP | 3.26 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane?
The IUPAC name of [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane (CID 11038971) is [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane.
What is the SMILES notation for [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane?
The canonical SMILES for [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane is C[C@H]1O[C@]1(C)C(C#C[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane?
The InChIKey is LYKGJDAUZZAXHE-YPHAAILGSA-N. The full InChI is InChI=1S/C13H26O2Si2/c1-11-13(2,14-11)12(15-17(6,7)8)9-10-16(3,4)5/h11-12H,1-8H3/t11-,12?,13+/m1/s1.
What are the key properties of [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane?
[3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane has a molecular weight of 270.52 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2S,3R)-2,3-dimethyloxiran-2-yl]-3-trimethylsilyloxyprop-1-ynyl]-trimethylsilane is sourced from PubChem (CID 11038971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).