C14H18N2O3 — CID 110390561
N-(2-methoxyethyl)-3-(2-methyl-1,3-benzoxazol-5-yl)propanamide (PubChem CID 110390561) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(2-methyl-1,3-benzoxazol-5-yl)propanamide.
| Compound Name | N-(2-methoxyethyl)-3-(2-methyl-1,3-benzoxazol-5-yl)propanamide |
|---|---|
| PubChem CID | 110390561 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-(2-methoxyethyl)-3-(2-methyl-1,3-benzoxazol-5-yl)propanamide |
| SMILES | COCCNC(=O)CCc1ccc2oc(C)nc2c1 |
| InChI | InChI=1S/C14H18N2O3/c1-10-16-12-9-11(3-5-13(12)19-10)4-6-14(17)15-7-8-18-2/h3,5,9H,4,6-8H2,1-2H3,(H,15,17) |
| InChIKey | HDHYICAZMQLDTC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|