C42H30N4O2 — CID 11039418
4-[N-(4-cyanophenyl)-4-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]anilino]benzonitrile (PubChem CID 11039418) has the molecular formula C42H30N4O2 and a molecular weight of 622.73 g/mol. Its IUPAC name is 4-[N-(4-cyanophenyl)-4-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]anilino]benzonitrile.
| Compound Name | 4-[N-(4-cyanophenyl)-4-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]anilino]benzonitrile |
|---|---|
| PubChem CID | 11039418 |
| Molecular Formula | C42H30N4O2 |
| Molecular Weight | 622.73 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | 4-[N-(4-cyanophenyl)-4-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethynyl]anilino]benzonitrile |
| SMILES | COc1ccc(N(c2ccc(C#Cc3ccc(N(c4ccc(C#N)cc4)c4ccc(C#N)cc4)cc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H30N4O2/c1-47-41-25-21-39(22-26-41)46(40-23-27-42(48-2)28-24-40)36-15-7-32(8-16-36)4-3-31-5-13-35(14-6-31)45(37-17-9-33(29-43)10-18-37)38-19-11-34(30-44)12-20-38/h5-28H,1-2H3 |
| InChIKey | HMWSYMANIRRUGT-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 72.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.73 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|