C19H19ClFNO3S — CID 110394846
[1-[(4-chlorophenyl)methylsulfonyl]piperidin-3-yl]-(4-fluorophenyl)methanone (PubChem CID 110394846) has the molecular formula C19H19ClFNO3S and a molecular weight of 395.88 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methylsulfonyl]piperidin-3-yl]-(4-fluorophenyl)methanone.
| Compound Name | [1-[(4-chlorophenyl)methylsulfonyl]piperidin-3-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 110394846 |
| Molecular Formula | C19H19ClFNO3S |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | [1-[(4-chlorophenyl)methylsulfonyl]piperidin-3-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)C1CCCN(S(=O)(=O)Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H19ClFNO3S/c20-17-7-3-14(4-8-17)13-26(24,25)22-11-1-2-16(12-22)19(23)15-5-9-18(21)10-6-15/h3-10,16H,1-2,11-13H2 |
| InChIKey | PJGVSYRYENNWKE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |