C35H33NO7S2 — CID 11039518
(4R,5S)-3-[(1R,2R,5S)-5-[bis(benzenesulfonyl)methyl]-2-methoxy-2-methylcyclopent-3-en-1-yl]-4,5-diphenyl-1,3-oxazolidin-2-one (PubChem CID 11039518) has the molecular formula C35H33NO7S2 and a molecular weight of 643.78 g/mol. Its IUPAC name is (4R,5S)-3-[(1R,2R,5S)-5-[bis(benzenesulfonyl)methyl]-2-methoxy-2-methylcyclopent-3-en-1-yl]-4,5-diphenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(1R,2R,5S)-5-[bis(benzenesulfonyl)methyl]-2-methoxy-2-methylcyclopent-3-en-1-yl]-4,5-diphenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11039518 |
| Molecular Formula | C35H33NO7S2 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.17 |
| IUPAC Name | (4R,5S)-3-[(1R,2R,5S)-5-[bis(benzenesulfonyl)methyl]-2-methoxy-2-methylcyclopent-3-en-1-yl]-4,5-diphenyl-1,3-oxazolidin-2-one |
| SMILES | CO[C@]1(C)C=C[C@H](C(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)[C@H]1N1C(=O)O[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C35H33NO7S2/c1-35(42-2)24-23-29(33(44(38,39)27-19-11-5-12-20-27)45(40,41)28-21-13-6-14-22-28)32(35)36-30(25-15-7-3-8-16-25)31(43-34(36)37)26-17-9-4-10-18-26/h3-24,29-33H,1-2H3/t29-,30+,31-,32+,35+/m0/s1 |
| InChIKey | VPXPQSQPMXDYSG-KNXMQKIASA-N |
| XLogP | 6.15 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|