About bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium
bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium (PubChem CID 11039604) has the molecular formula C30H68P4Pd
and a molecular weight of 659.19 g/mol. Its IUPAC name is bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium.
Molecular Properties
| Compound Name | bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium |
| PubChem CID | 11039604 |
| Molecular Formula | C30H68P4Pd |
| Molecular Weight | 659.19 g/mol |
| Exact Mass | 658.33 |
| IUPAC Name | bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium |
| SMILES | CC(C)P(CCCP(C(C)C)C(C)C)C(C)C.CC(C)P(CCCP(C(C)C)C(C)C)C(C)C.[Pd] |
| InChI | InChI=1S/2C15H34P2.Pd/c2*1-12(2)16(13(3)4)10-9-11-17(14(5)6)15(7)8;/h2*12-15H,9-11H2,1-8H3; |
| InChIKey | OYTRFAKJOIUDDD-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 659.19 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium?
The IUPAC name of bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium (CID 11039604) is bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium.
What is the SMILES notation for bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium?
The canonical SMILES for bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium is CC(C)P(CCCP(C(C)C)C(C)C)C(C)C.CC(C)P(CCCP(C(C)C)C(C)C)C(C)C.[Pd].
What is the InChIKey of bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium?
The InChIKey is OYTRFAKJOIUDDD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H34P2.Pd/c2*1-12(2)16(13(3)4)10-9-11-17(14(5)6)15(7)8;/h2*12-15H,9-11H2,1-8H3;.
What are the key properties of bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium?
bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium has a molecular weight of 659.19 g/mol, XLogP of 11.95, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-di(propan-2-yl)phosphanylpropyl-di(propan-2-yl)phosphane);palladium is sourced from PubChem (CID 11039604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).