C22H27NO4 — CID 110396864
1-[4-(4-methoxyphenoxy)piperidin-1-yl]-3-(3-methoxyphenyl)propan-1-one (PubChem CID 110396864) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenoxy)piperidin-1-yl]-3-(3-methoxyphenyl)propan-1-one.
| Compound Name | 1-[4-(4-methoxyphenoxy)piperidin-1-yl]-3-(3-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 110396864 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-[4-(4-methoxyphenoxy)piperidin-1-yl]-3-(3-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc(OC2CCN(C(=O)CCc3cccc(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-25-18-7-9-19(10-8-18)27-20-12-14-23(15-13-20)22(24)11-6-17-4-3-5-21(16-17)26-2/h3-5,7-10,16,20H,6,11-15H2,1-2H3 |
| InChIKey | ARTYUMMDORYMGF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |