C38H50F6N2Si2 — CID 11039797
3-N,4-N-bis[4-(trifluoromethyl)phenyl]-1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-diimine (PubChem CID 11039797) has the molecular formula C38H50F6N2Si2 and a molecular weight of 704.99 g/mol. Its IUPAC name is 3-N,4-N-bis[4-(trifluoromethyl)phenyl]-1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-diimine.
| Compound Name | 3-N,4-N-bis[4-(trifluoromethyl)phenyl]-1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-diimine |
|---|---|
| PubChem CID | 11039797 |
| Molecular Formula | C38H50F6N2Si2 |
| Molecular Weight | 704.99 g/mol |
| Exact Mass | 704.34 |
| IUPAC Name | 3-N,4-N-bis[4-(trifluoromethyl)phenyl]-1,6-bis[tri(propan-2-yl)silyl]hexa-1,5-diyne-3,4-diimine |
| SMILES | CC(C)[Si](C#CC(=N\c1ccc(C(F)(F)F)cc1)/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=N/c1ccc(C(F)(F)F)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H50F6N2Si2/c1-25(2)47(26(3)4,27(5)6)23-21-35(45-33-17-13-31(14-18-33)37(39,40)41)36(22-24-48(28(7)8,29(9)10)30(11)12)46-34-19-15-32(16-20-34)38(42,43)44/h13-20,25-30H,1-12H3/b45-35+,46-36+ |
| InChIKey | YVFGMMWBMLIVDH-HZOSDRPUSA-N |
| XLogP | 13.01 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.99 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|