About methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate
methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate (PubChem CID 110398213) has the molecular formula C12H19N3O2S
and a molecular weight of 269.37 g/mol. Its IUPAC name is methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate.
Analyze methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate?
The IUPAC name of methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate (CID 110398213) is methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate.
What is the SMILES notation for methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate?
The canonical SMILES for methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate is COC(=O)NCCc1csc(N2CCCCC2)n1.
What is the InChIKey of methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate?
The InChIKey is JVLLONPWCJLNLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2S/c1-17-12(16)13-6-5-10-9-18-11(14-10)15-7-3-2-4-8-15/h9H,2-8H2,1H3,(H,13,16).
What are the key properties of methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate?
methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate has a molecular weight of 269.37 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[2-(2-piperidin-1-yl-1,3-thiazol-4-yl)ethyl]carbamate is sourced from PubChem (CID 110398213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).