C20H23NO4S — CID 110399988
N-(2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-6-yl)-1-(3-methylphenyl)methanesulfonamide (PubChem CID 110399988) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is N-(2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-6-yl)-1-(3-methylphenyl)methanesulfonamide.
| Compound Name | N-(2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-6-yl)-1-(3-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 110399988 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | N-(2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-6-yl)-1-(3-methylphenyl)methanesulfonamide |
| SMILES | Cc1cccc(CS(=O)(=O)NC2CCCc3cc4c(cc32)OCCO4)c1 |
| InChI | InChI=1S/C20H23NO4S/c1-14-4-2-5-15(10-14)13-26(22,23)21-18-7-3-6-16-11-19-20(12-17(16)18)25-9-8-24-19/h2,4-5,10-12,18,21H,3,6-9,13H2,1H3 |
| InChIKey | XYTFRXHJNAABTR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |