C19H18N2O4S — CID 110400004
2-cyano-N-(2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-6-yl)benzenesulfonamide (PubChem CID 110400004) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-cyano-N-(2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-6-yl)benzenesulfonamide.
| Compound Name | 2-cyano-N-(2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110400004 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-cyano-N-(2,3,6,7,8,9-hexahydrobenzo[g][1,4]benzodioxin-6-yl)benzenesulfonamide |
| SMILES | N#Cc1ccccc1S(=O)(=O)NC1CCCc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C19H18N2O4S/c20-12-14-4-1-2-7-19(14)26(22,23)21-16-6-3-5-13-10-17-18(11-15(13)16)25-9-8-24-17/h1-2,4,7,10-11,16,21H,3,5-6,8-9H2 |
| InChIKey | AAXINLLLCUKOFH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |