C42H39Cl2NOP2Ru — CID 11040094
dichlororuthenium;diphenyl-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane;triphenylphosphane (PubChem CID 11040094) has the molecular formula C42H39Cl2NOP2Ru and a molecular weight of 807.70 g/mol. Its IUPAC name is dichlororuthenium;diphenyl-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane;triphenylphosphane.
| Compound Name | dichlororuthenium;diphenyl-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane;triphenylphosphane |
|---|---|
| PubChem CID | 11040094 |
| Molecular Formula | C42H39Cl2NOP2Ru |
| Molecular Weight | 807.70 g/mol |
| Exact Mass | 807.09 |
| IUPAC Name | dichlororuthenium;diphenyl-[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]phosphane;triphenylphosphane |
| SMILES | CC(C)[C@H]1COC(c2ccccc2P(c2ccccc2)c2ccccc2)=N1.Cl[Ru]Cl.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24NOP.C18H15P.2ClH.Ru/c1-18(2)22-17-26-24(25-22)21-15-9-10-16-23(21)27(19-11-5-3-6-12-19)20-13-7-4-8-14-20;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;/h3-16,18,22H,17H2,1-2H3;1-15H;2*1H;/q;;;;+2/p-2/t22-;;;;/m1..../s1 |
| InChIKey | DMGNAOPSGGGFNC-VTTXPQSASA-L |
| XLogP | 9.07 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.70 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|