C42H86O4Si2Sn — CID 11040151
methyl (3R,5S,6S,7R)-6-methyl-3-[(E)-2-tributylstannylethenyl]-5-triethylsilyloxy-7-tri(propan-2-yl)silyloxyundec-10-enoate (PubChem CID 11040151) has the molecular formula C42H86O4Si2Sn and a molecular weight of 830.03 g/mol. Its IUPAC name is methyl (3R,5S,6S,7R)-6-methyl-3-[(E)-2-tributylstannylethenyl]-5-triethylsilyloxy-7-tri(propan-2-yl)silyloxyundec-10-enoate.
| Compound Name | methyl (3R,5S,6S,7R)-6-methyl-3-[(E)-2-tributylstannylethenyl]-5-triethylsilyloxy-7-tri(propan-2-yl)silyloxyundec-10-enoate |
|---|---|
| PubChem CID | 11040151 |
| Molecular Formula | C42H86O4Si2Sn |
| Molecular Weight | 830.03 g/mol |
| Exact Mass | 830.51 |
| IUPAC Name | methyl (3R,5S,6S,7R)-6-methyl-3-[(E)-2-tributylstannylethenyl]-5-triethylsilyloxy-7-tri(propan-2-yl)silyloxyundec-10-enoate |
| SMILES | C=CCC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)[C@H](CC(/C=C/[Sn](CCCC)(CCCC)CCCC)CC(=O)OC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C30H59O4Si2.3C4H9.Sn/c1-14-19-20-28(34-36(23(6)7,24(8)9)25(10)11)26(12)29(33-35(16-3,17-4)18-5)21-27(15-2)22-30(31)32-13;3*1-3-4-2;/h2,14-15,23-29H,1,16-22H2,3-13H3;3*1,3-4H2,2H3;/t26-,27?,28+,29-;;;;/m0..../s1 |
| InChIKey | IMMWDLHJPWJSGV-YLARQQNOSA-N |
| XLogP | 14.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.03 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|