C13H13N5O3S — CID 110401691
2,6-dimethoxy-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)benzamide (PubChem CID 110401691) has the molecular formula C13H13N5O3S and a molecular weight of 319.35 g/mol. Its IUPAC name is 2,6-dimethoxy-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)benzamide.
| Compound Name | 2,6-dimethoxy-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)benzamide |
|---|---|
| PubChem CID | 110401691 |
| Molecular Formula | C13H13N5O3S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2,6-dimethoxy-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)benzamide |
| SMILES | COc1cccc(OC)c1C(=O)NCc1nn2cnnc2s1 |
| InChI | InChI=1S/C13H13N5O3S/c1-20-8-4-3-5-9(21-2)11(8)12(19)14-6-10-17-18-7-15-16-13(18)22-10/h3-5,7H,6H2,1-2H3,(H,14,19) |
| InChIKey | LLOUUJWBRLDSJO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |