About N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide
N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide (PubChem CID 110402641) has the molecular formula C18H15FN2O4
and a molecular weight of 342.33 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide.
Molecular Properties
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide |
| PubChem CID | 110402641 |
| Molecular Formula | C18H15FN2O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide |
| SMILES | COc1ccc(-c2cnoc2NC(=O)c2ccccc2F)cc1OC |
| InChI | InChI=1S/C18H15FN2O4/c1-23-15-8-7-11(9-16(15)24-2)13-10-20-25-18(13)21-17(22)12-5-3-4-6-14(12)19/h3-10H,1-2H3,(H,21,22) |
| InChIKey | XLGISRFTLUVSSJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide?
The IUPAC name of N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide (CID 110402641) is N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide.
What is the SMILES notation for N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide?
The canonical SMILES for N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide is COc1ccc(-c2cnoc2NC(=O)c2ccccc2F)cc1OC.
What is the InChIKey of N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide?
The InChIKey is XLGISRFTLUVSSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN2O4/c1-23-15-8-7-11(9-16(15)24-2)13-10-20-25-18(13)21-17(22)12-5-3-4-6-14(12)19/h3-10H,1-2H3,(H,21,22).
What are the key properties of N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide?
N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide has a molecular weight of 342.33 g/mol, XLogP of 3.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2-fluorobenzamide is sourced from PubChem (CID 110402641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).