C18H14F2N2O4 — CID 110402678
N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-3,4-difluorobenzamide (PubChem CID 110402678) has the molecular formula C18H14F2N2O4 and a molecular weight of 360.32 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-3,4-difluorobenzamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 110402678 |
| Molecular Formula | C18H14F2N2O4 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-3,4-difluorobenzamide |
| SMILES | COc1ccc(-c2cnoc2NC(=O)c2ccc(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C18H14F2N2O4/c1-24-15-6-4-10(8-16(15)25-2)12-9-21-26-18(12)22-17(23)11-3-5-13(19)14(20)7-11/h3-9H,1-2H3,(H,22,23) |
| InChIKey | WMENLKOLFIYIIO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |