C18H13F3N2O4 — CID 110402679
N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2,3,4-trifluorobenzamide (PubChem CID 110402679) has the molecular formula C18H13F3N2O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 110402679 |
| Molecular Formula | C18H13F3N2O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]-2,3,4-trifluorobenzamide |
| SMILES | COc1ccc(-c2cnoc2NC(=O)c2ccc(F)c(F)c2F)cc1OC |
| InChI | InChI=1S/C18H13F3N2O4/c1-25-13-6-3-9(7-14(13)26-2)11-8-22-27-18(11)23-17(24)10-4-5-12(19)16(21)15(10)20/h3-8H,1-2H3,(H,23,24) |
| InChIKey | JQYWPPDDZNXJPA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|