C19H30N2O — CID 110403747
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-methylpentyl]butanamide (PubChem CID 110403747) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-methylpentyl]butanamide.
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-methylpentyl]butanamide |
|---|---|
| PubChem CID | 110403747 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-4-methylpentyl]butanamide |
| SMILES | CCCC(=O)NCC(CC(C)C)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H30N2O/c1-4-7-19(22)20-13-18(12-15(2)3)21-11-10-16-8-5-6-9-17(16)14-21/h5-6,8-9,15,18H,4,7,10-14H2,1-3H3,(H,20,22) |
| InChIKey | SJALMNMRTOZJGJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |