C18H21N5O3S — CID 110404258
2-[4-(4-methoxy-2-methylphenyl)sulfonylpiperazin-1-yl]-6-methylpyrimidine-4-carbonitrile (PubChem CID 110404258) has the molecular formula C18H21N5O3S and a molecular weight of 387.47 g/mol. Its IUPAC name is 2-[4-(4-methoxy-2-methylphenyl)sulfonylpiperazin-1-yl]-6-methylpyrimidine-4-carbonitrile.
| Compound Name | 2-[4-(4-methoxy-2-methylphenyl)sulfonylpiperazin-1-yl]-6-methylpyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 110404258 |
| Molecular Formula | C18H21N5O3S |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-[4-(4-methoxy-2-methylphenyl)sulfonylpiperazin-1-yl]-6-methylpyrimidine-4-carbonitrile |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3nc(C)cc(C#N)n3)CC2)c(C)c1 |
| InChI | InChI=1S/C18H21N5O3S/c1-13-10-16(26-3)4-5-17(13)27(24,25)23-8-6-22(7-9-23)18-20-14(2)11-15(12-19)21-18/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | BZQWMTFQFRDUMC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 99.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |