About 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide
2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide (PubChem CID 110404629) has the molecular formula C16H22N2O3
and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide.
Molecular Properties
| Compound Name | 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide |
| PubChem CID | 110404629 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide |
| SMILES | CCC(CC)C(=O)NCCC1Oc2ccccc2NC1=O |
| InChI | InChI=1S/C16H22N2O3/c1-3-11(4-2)15(19)17-10-9-14-16(20)18-12-7-5-6-8-13(12)21-14/h5-8,11,14H,3-4,9-10H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | WBXYNPSXDNQLMF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide?
The IUPAC name of 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide (CID 110404629) is 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide.
What is the SMILES notation for 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide?
The canonical SMILES for 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide is CCC(CC)C(=O)NCCC1Oc2ccccc2NC1=O.
What is the InChIKey of 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide?
The InChIKey is WBXYNPSXDNQLMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O3/c1-3-11(4-2)15(19)17-10-9-14-16(20)18-12-7-5-6-8-13(12)21-14/h5-8,11,14H,3-4,9-10H2,1-2H3,(H,17,19)(H,18,20).
What are the key properties of 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide?
2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide has a molecular weight of 290.36 g/mol, XLogP of 2.33, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-[2-(3-oxo-4H-1,4-benzoxazin-2-yl)ethyl]butanamide is sourced from PubChem (CID 110404629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).